CAS 102783-50-6

3′-Cytidylic acid, 2′-deoxy-, diammonium salt

Description:

3′-Cytidylic acid, 2′-deoxy-, diammonium salt, also known as deoxycytidine monophosphate (dCMP) diammonium salt, is a nucleotide derivative that plays a crucial role in the structure of DNA. This compound consists of a pyrimidine base (cytosine), a sugar (deoxyribose), and a phosphate group, which are essential components of nucleic acids. The diammonium salt form indicates the presence of two ammonium ions associated with the phosphate group, enhancing its solubility in aqueous solutions. This substance is typically white to off-white in appearance and is soluble in water, making it suitable for various biochemical applications, including molecular biology and genetic research. It is often used in the synthesis of nucleic acids and as a building block in the production of DNA. Additionally, dCMP is involved in cellular metabolism and can be phosphorylated to form dCTP, which is essential for DNA replication and repair processes. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₁₄N₃O₇P·2H₃N

InChI: InChI=1S/C9H14N3O7P.2H3N/c10-7-1-2-12(9(14)11-7)8-3-5(6(4-13)18-8)19-20(15,16)17;;/h1-2,5-6,8,13H,3-4H2,(H2,10,11,14)(H2,15,16,17);2*1H3/t5-,6+,8+;;/m0../s1

InChI key: InChIKey=ZDTKTKLIZWCBLF-CDNBRZBRSA-N

SMILES: O=C1N([C@H]2C[C@H](OP(=O)(O)O)[C@@H](CO)O2)C=CC(N)=N1.N

Synonyms:

• 3′-Cytidylic acid, 2′-deoxy-, diammonium salt
• 4-amino-1-(2-deoxy-3-O-phosphonopentofuranosyl)pyrimidin-2(1H)-one ammoniate

2′-Deoxycytidine 3′-monophosphate ammonium salt

CAS: 102783-50-6

Formula: C₉H₁₄N₃O₇P·xNH₃

Molecular weight: 307.20 (free acid b

Ref: 7W-GK3003

2'-Deoxycytidine-3'-monophosphate ammonium salt

CAS: 102783-50-6

2'-Deoxycytidine-3'-monophosphate ammonium salt is a synthetic compound that is used in the production of phosphite fertilizers. It is also used to detect the presence of phosphorus and sulfur in elements, as well as to synthesize alkylene compounds. In addition, 2'-Deoxycytidine-3'-monophosphate ammonium salt can be used in the synthesis of ribozymes and deoxyadenosyl compounds.

Formula: C₉H₁₄N₃O₇P·2NH₃

Purity: Min. 95%

Molecular weight: 341.26 g/mol

Ref: 3D-ND46693