CAS 102783-53-9

2-3-diphospho-D-glyceric acid*pentasodium

Description:

2,3-Diphospho-D-glyceric acid pentasodium, with the CAS number 102783-53-9, is a phosphoric acid derivative that plays a significant role in biochemical processes, particularly in the context of metabolic pathways. This compound features two phosphate groups attached to a glyceric acid backbone, which contributes to its high polarity and solubility in aqueous solutions. The presence of multiple sodium ions in its pentasodium salt form enhances its stability and solubility, making it suitable for various applications in biochemical research and industrial processes. Its structure allows it to participate in enzymatic reactions and serve as a substrate or intermediate in metabolic pathways, particularly in the context of energy metabolism and cellular signaling. Additionally, due to its ionic nature, it can influence the pH of solutions and interact with other biomolecules, making it a valuable compound in studies related to enzymology and cellular biochemistry. Overall, 2,3-diphospho-D-glyceric acid pentasodium is an important compound in the field of biochemistry, particularly in studies involving energy transfer and metabolic regulation.

Formula: C₃H₈NaO₁₀P₂

InChI: InChI=1/C3H8O10P2.Na/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8;/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11);/t2-;/m1./s1

SMILES: C([C@H](C(=O)O)OP(=O)(O)O)OP(=O)(O)O.[Na]

Synonyms:

• 2,3-Diphospho-D-glyceric acid pentasodium salt
• propanoic acid, 2,3-bis(phosphonooxy)-, monosodium salt, (2R)-

2,3-Diphospho-D-glyceric acid (pentasodium salt)

CAS: 102783-53-9

Formula: C₃H₃Na₅O₁₀P₂

Purity: 90%

Molecular weight: 375.9463

Ref: IN-DA003FKV

2,3-Diphospho-D-glyceric acid pentasodium salt

CAS: 102783-53-9

2,3-Diphospho-D-glyceric acid pentasodium salt is a pyridine complex that is found in nature as a constant. It is also synthesized by humans and can be formed in the laboratory. 2,3-Diphospho-D-glyceric acid pentasodium salt is reactive and has been shown to be useful for producing radical species. This compound has been analysed in the human body at physiological concentrations and has been shown to interact with endogenous molecules such as lipids. The interaction of this compound with lipids could be due to its ability to form emulsions.

Formula: C₃H₃Na₅O₁₀P₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 375.95 g/mol

Ref: 3D-FD22517

2,3-Diphospho-D-glyceric acid pentasodium salt

CAS: 102783-53-9

2,3-Diphospho-D-glyceric acid pentasodium salt is a highly anionic polyphosphorus compound located within the concave center of red blood cells, where it

Formula: C₃H₃Na₅O₁₀P₂

Color and Shape: Solid

Molecular weight: 375.95

Ref: TM-T83406