CAS 1027833-17-5

1-Bromo-2-chloro-5-fluoro-4-nitrobenzene

Description:

1-Bromo-2-chloro-5-fluoro-4-nitrobenzene is an aromatic halogenated compound characterized by the presence of multiple substituents on a benzene ring. The molecule features a bromine atom, a chlorine atom, a fluorine atom, and a nitro group, which significantly influence its chemical properties and reactivity. The presence of these electronegative halogens and the nitro group contributes to the compound's overall polarity and can affect its solubility in various solvents. This compound is likely to exhibit electrophilic aromatic substitution reactions due to the activating nature of the nitro group and the deactivating effects of the halogens. Additionally, the arrangement of substituents on the benzene ring can lead to specific steric and electronic effects, impacting its reactivity and potential applications in organic synthesis or as an intermediate in the production of pharmaceuticals and agrochemicals. Safety considerations should be taken into account due to the presence of halogens and the nitro group, which can pose environmental and health risks.

Formula: C₆H₂BrClFNO₂

InChI: InChI=1S/C6H2BrClFNO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H

SMILES: c1c(c(cc(c1F)N(=O)=O)Cl)Br

Synonyms:

• Benzene, 1-bromo-2-chloro-5-fluoro-4-nitro-

1-Bromo-2-chloro-5-fluoro-4-nitrobenzene

CAS: 1027833-17-5

Formula: C₆H₂BrClFNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.4410

Ref: IN-DA007J6Q

4-Bromo-5-chloro-2-fluoronitrobenzene

CAS: 1027833-17-5

4-Bromo-5-chloro-2-fluoronitrobenzene

Formula: C₆H₂BrClFNO₂

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 254.44g/mol

Ref: 54-PC53455

1-Bromo-2-chloro-5-fluoro-4-nitrobenzene

CAS: 1027833-17-5

Formula: C₆H₂BrClFNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.44

Ref: 10-F212124