CAS 102789-79-7
:1-Amino-2-Methylindoline HCL
Description:
1-Amino-2-methylindoline hydrochloride, with the CAS number 102789-79-7, is a chemical compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring. This compound features an amino group (-NH2) and a methyl group (-CH3) attached to the indoline framework, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water, which enhances its utility in various applications. The presence of the amino group allows for potential reactivity in organic synthesis, making it valuable in pharmaceutical research and development. Additionally, its structural characteristics may impart specific biological activities, which can be explored in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are observed. Overall, 1-amino-2-methylindoline HCl is an important compound in the field of organic chemistry and drug development.
Formula:C9H13ClN2
InChI:InChI=1/C9H12N2.ClH/c1-7-6-8-4-2-3-5-9(8)11(7)10;/h2-5,7H,6,10H2,1H3;1H
SMILES:CC1Cc2ccccc2N1N.Cl
Synonyms:- 2,3-Dihydro-2-methyl-1H-indol-1-amine hydrochloride
- 1-Amino-2-methylindoline hydrochloride
- 1-Amion-2-Methylindoline hydrochloride
- 2-methyl-2,3-dihydro-1H-indol-1-amine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Methylindolin-1-amine hydrochloride
CAS:Formula:C9H13ClN2Purity:97%Color and Shape:SolidMolecular weight:184.66591-Amino-2-methylindoline Hydrochloride
CAS:Controlled ProductFormula:C9H12N2·ClHColor and Shape:NeatMolecular weight:184.672,3-Dihydro-2-methyl-1H-indol-1-amine Hydrochloride
CAS:Controlled ProductApplications 2,3-Dihydro-2-methyl-1H-indol-1-amine Hydrochloride is an synthetic intermediate of Indapamide (I500100), an antihypertensive agent and a diuretic.
References Leary, et al.: Curr. Ther. Res., 15, 571 (1973), Kyncl, J., et al.: Arzneim.-Forsch., 25, 1491 (1975), DiFeo, T.J., et al.: Anal. Profiles Drug Subs. Excip., 23, 229 (1994),Formula:C9H12N2·ClHColor and Shape:Light BrownMolecular weight:184.67




