CAS 1027991-91-8
:5-FLUORO-1,3-DIMETHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID
Description:
5-Fluoro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrazole ring structure, which features a fluorine atom and two methyl groups attached to the nitrogen and carbon atoms of the ring. This compound is notable for its carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the fluorine atom can enhance the compound's biological activity and lipophilicity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and stability in different solvents. The compound is typically synthesized through specific organic reactions that introduce the fluorine and methyl groups while forming the pyrazole ring. Due to its unique structure, 5-fluoro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid may exhibit potential applications in agrochemicals or medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its biological properties and mechanisms of action are essential for understanding its full potential.
Formula:C6H7FN2O2
InChI:InChI=1S/C6H7FN2O2/c1-3-4(6(10)11)5(7)9(2)8-3/h1-2H3,(H,10,11)
InChI key:HTMQNNFTTWLPIE-UHFFFAOYSA-N
SMILES:CC1=NN(C(=C1C(=O)O)F)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery