CAS 1028-38-2
:3-(3-CHLORO-PHENYL)-2-MERCAPTO-3H-QUINAZOLIN-4-ONE
Description:
3-(3-Chloro-phenyl)-2-mercapto-3H-quinazolin-4-one, with the CAS number 1028-38-2, is a chemical compound that belongs to the quinazolinone class. This substance features a quinazolinone core structure, which is characterized by a fused benzene and pyrimidine ring system. The presence of a mercapto (-SH) group contributes to its potential reactivity and biological activity, while the chloro substituent on the phenyl ring can influence its pharmacological properties. This compound is often studied for its potential applications in medicinal chemistry, particularly for its antimicrobial and anticancer activities. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in experimental settings. Additionally, the compound's structure allows for various modifications, which can lead to derivatives with enhanced or altered biological activities. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks.
Formula:C14H9ClN2OS
InChI:InChI=1/C14H9ClN2OS/c15-9-4-3-5-10(8-9)17-13(18)11-6-1-2-7-12(11)16-14(17)19/h1-8H,(H,16,19)
SMILES:c1ccc2c(c1)c(=O)n(c1cccc(c1)Cl)c(n2)S
Synonyms:- 3-(3-Chlorophenyl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one
- 4(1H)-Quinazolinone, 3-(3-chlorophenyl)-2,3-dihydro-2-thioxo-
- 4(3H)-quinazolinone, 3-(3-chlorophenyl)-2-mercapto-
- 3-(3-Chloro-phenyl)-2-mercapto-3H-quinazolin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.