CymitQuimica logo

CAS 1028-40-6

:

3-(4-CHLORO-PHENYL)-2-MERCAPTO-3H-QUINAZOLIN-4-ONE

Description:
3-(4-Chloro-phenyl)-2-mercapto-3H-quinazolin-4-one, with the CAS number 1028-40-6, is a chemical compound that belongs to the quinazolinone class, characterized by its fused bicyclic structure. This compound features a mercapto (-SH) group and a chloro-substituted phenyl group, which contribute to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the mercapto group suggests potential for thiol-related reactions, while the chloro substituent can influence its electronic properties and reactivity. This compound has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its synthesis often involves multi-step organic reactions, and it may be used as a building block in the development of more complex molecules. As with many chemical substances, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C14H9ClN2OS
InChI:InChI=1/C14H9ClN2OS/c15-9-5-7-10(8-6-9)17-13(18)11-3-1-2-4-12(11)16-14(17)19/h1-8H,(H,16,19)
SMILES:c1ccc2c(c1)c(=O)n(c1ccc(cc1)Cl)c(n2)S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.