CAS 1028-91-7
:2-[Nitroso(phenylmethyl)amino]benzoic acid
Description:
2-[Nitroso(phenylmethyl)amino]benzoic acid, with the CAS number 1028-91-7, is a chemical compound characterized by its nitroso group and amino functionality attached to a benzoic acid structure. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the nitroso group imparts unique reactivity, allowing for participation in various chemical reactions, including diazotization and coupling reactions. The phenylmethyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the carboxylic acid group in the benzoic acid moiety can engage in hydrogen bonding, affecting its interactions in biological systems and its overall reactivity. Safety data indicates that, like many nitroso compounds, it should be handled with care due to potential toxicity and reactivity. Overall, this compound serves as an interesting subject for further research in both synthetic and medicinal chemistry.
Formula:C14H12N2O3
InChI:InChI=1/C14H12N2O3/c17-14(18)12-8-4-5-9-13(12)16(15-19)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,17,18)
InChI key:InChIKey=VXZOBNZOEBYBFR-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(N=O)C2=C(C(O)=O)C=CC=C2
Synonyms:- Anthranilic acid, N-benzyl-N-nitroso-
- Benzoic acid, 2-[nitroso(phenylmethyl)amino]-
- 2-[Nitroso(phenylmethyl)amino]benzoic acid
- N-Benzyl-N-nitrosoanthranilic acid
- 2-[benzyl(nitroso)amino]benzoic acid
- 2-(Nitroso(phenylmethyl)amino)benzoic acid
- 2-[nitroso(phenylmethyl)amino]benzoic acid Q: What is the CAS Number of
- 2-[nitroso(phenylmethyl)amino]benzoic acid(Mixture of isomers)
- 2-[nitroso(phenylmethyl)amino]benzoic acidQ: What is
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-[Nitroso(phenylmethyl)amino]benzoic Acid
CAS:Controlled ProductFormula:C14H12N2O3Color and Shape:NeatMolecular weight:256.257


