CymitQuimica logo

CAS 102803-21-4

:

Thieno[2,3-b]thiophene, homopolymer

Description:
Thieno[2,3-b]thiophene, homopolymer, is a conjugated polymer derived from the thieno[2,3-b]thiophene monomer, which is a heterocyclic compound featuring a fused thiophene structure. This polymer exhibits notable electrical conductivity and is of interest in organic electronics, particularly in organic photovoltaic cells and field-effect transistors. Its structure contributes to a planar conformation, facilitating π-π stacking interactions, which enhance charge transport properties. The material is typically characterized by its solubility in organic solvents, thermal stability, and tunable optical properties, making it suitable for various applications in organic semiconductors. Additionally, the polymer's bandgap can be adjusted through chemical modifications, allowing for the optimization of its electronic properties for specific applications. The synthesis of this homopolymer often involves methods such as oxidative polymerization or electrochemical polymerization, which can influence its molecular weight and degree of crystallinity. Overall, thieno[2,3-b]thiophene, homopolymer, represents a significant class of materials in the field of organic electronics due to its unique structural and electronic characteristics.
Formula:(C6H4S2)x
InChI:InChI=1S/C6H4S2/c1-3-7-6-5(1)2-4-8-6/h1-4H
InChI key:InChIKey=YHBTXTFFTYXOFV-UHFFFAOYSA-N
SMILES:C12=C(SC=C1)SC=C2
Synonyms:
  • Poly(thieno[2,3-b]thiophene)
  • Thieno[2,3-b]thiophene, homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.