CAS 102804-44-4
:2-Butenamide, N-(2-bromophenyl)-, (E)-
Description:
2-Butenamide, N-(2-bromophenyl)-, (E)- is an organic compound characterized by its amide functional group and a double bond configuration, specifically in the E (trans) configuration. This compound features a butenamide backbone, which consists of a four-carbon chain with a double bond between the second and third carbon atoms, and an amide group (-C(=O)N-) attached to the terminal carbon. The presence of the 2-bromophenyl substituent indicates that a bromine atom is attached to the second position of a phenyl ring, contributing to the compound's unique reactivity and potential applications in organic synthesis. The E configuration of the double bond suggests that the substituents on either side of the double bond are on opposite sides, which can influence the compound's physical properties, such as boiling point and solubility. Overall, this compound may exhibit interesting biological activity and could be of interest in medicinal chemistry and materials science.
Formula:C10H10BrNO
InChI:InChI=1S/C10H10BrNO/c1-2-5-10(13)12-9-7-4-3-6-8(9)11/h2-7H,1H3,(H,12,13)/b5-2+
InChI key:InChIKey=HPUOLTWVVYKUBT-GORDUTHDSA-N
SMILES:N(C(/C=C/C)=O)C1=C(Br)C=CC=C1
Synonyms:- 2-Butenamide, N-(2-bromophenyl)-, (E)-
- 2-butenamide, N-(2-bromophenyl)-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.