CAS 102807-51-2
:1,2-DIOLEOYL-3-(PYREN-1-YL) DECANOYL-RAC-GLYCEROL
Description:
1,2-Dioleoyl-3-(pyren-1-yl) decanoyl-rac-glycerol, with the CAS number 102807-51-2, is a synthetic lipid compound characterized by its unique structure that includes two oleoyl fatty acid chains and a pyrene moiety attached to a glycerol backbone. This compound is amphiphilic, meaning it possesses both hydrophilic and hydrophobic properties, which makes it suitable for various applications in biochemistry and nanotechnology, particularly in drug delivery systems and as a fluorescent probe. The presence of the pyrene group contributes to its photophysical properties, allowing for potential use in fluorescence microscopy and sensing applications. Additionally, the fatty acid chains enhance its ability to form lipid bilayers or micelles in aqueous environments, facilitating the encapsulation of hydrophobic drugs. Its stability and biocompatibility are essential for its use in biological systems, making it a valuable compound in the development of lipid-based formulations. Overall, this compound exemplifies the intersection of organic chemistry and materials science, with promising applications in biomedical research.
Formula:C65H98O6
InChI:InChI=1/C65H98O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-29-33-37-44-61(66)69-53-59(71-63(68)46-39-35-30-26-24-22-20-18-16-14-12-10-8-6-4-2)54-70-62(67)45-38-34-31-27-28-32-36-41-55-47-48-58-50-49-56-42-40-43-57-51-52-60(55)65(58)64(56)57/h17-20,40,42-43,47-52,59H,3-16,21-39,41,44-46,53-54H2,1-2H3/b19-17-,20-18-
Synonyms:- 1-Pyrenedecanoic acid, 2,3-bis[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]propyl ester
- 3-{[10-(Pyren-1-yl)decanoyl]oxy}propane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate
- 1-Pyrenedecanoic acid, 2,3-bis((1-oxo-9-octadecenyl)oxy)propyl ester, (Z,Z)-
- 3-[(10-pyren-1-yldecanoyl)oxy]propane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.