CAS 102814-03-9

2'-deoxyguanosine 3'-monophosphate*sodium

Description:

2'-Deoxyguanosine 3'-monophosphate sodium (dGMP-Na) is a nucleotide that plays a crucial role in the structure of nucleic acids and cellular metabolism. It is a derivative of guanosine, where the ribose sugar is in its deoxy form, meaning it lacks an oxygen atom at the 2' position. The "3'-monophosphate" designation indicates that it has a phosphate group attached to the 3' carbon of the sugar, which is essential for the formation of nucleic acid polymers. As a sodium salt, it is often used in biochemical and molecular biology applications due to its solubility in aqueous solutions. dGMP-Na is involved in various cellular processes, including DNA synthesis and repair, and serves as a building block for RNA and DNA. Its structure includes a purine base (guanine), a deoxyribose sugar, and a phosphate group, contributing to its role in energy transfer and signaling pathways within cells. Additionally, it can be utilized in research settings for the synthesis of oligonucleotides and in studies related to gene expression and regulation.

Formula: C₁₀H₁₄N₅NaO₇P

InChI: InChI=1/C10H14N5O7P.Na/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(5(2-16)21-6)22-23(18,19)20;/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17);

SMILES: C1C(C(CO)OC1n1cnc2c1[nH]c(=N)nc2O)OP(=O)(O)O.[Na]

Synonyms:

• 6H-purin-6-one, 2-amino-9-(2-deoxy-3-O-phosphonopentofuranosyl)-3,9-dihydro-, monosodium salt
• 2'-Deoxyguanosine 3'-Monophosphate Sodium Salt
• 2'-Deoxyguanosine-3'-monophosphate,Disodium salt

2''-Deoxyguanosine 3''-monophosphate sodium salt

CAS: 102814-03-9

Formula: C₁₀H₁₄N₅O₇P·xNa

Molecular weight: 347.22 (free acid b

Ref: 7W-GN9838

2'-Deoxyguanosine 3'-monophosphate sodium

CAS: 102814-03-9

2'-Deoxyguanosine 3'-monophosphate sodium is a novel, synthetic nucleoside that inhibits DNA replication and transcription. It has been shown to be a potent inhibitor of human immunodeficiency virus type 1 (HIV-1) and human T-cell leukemia virus type I (HTLV-I). 2'-Deoxyguanosine 3'-monophosphate sodium is in the category of nucleosides, which are phosphorylated compounds that can be incorporated into DNA by DNA polymerase. This product has a high purity and is synthesized from diphosphate.

Formula: C₁₀H₁₂Na₂N₅O₇P

Purity: Min. 95%

Color and Shape: White Off-White Powder

Molecular weight: 391.19 g/mol

Ref: 3D-ND05424