CAS 102816-25-1

α-D-Glucopyranosyl azide, 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, 3,4,6-triacetate

Description:

α-D-Glucopyranosyl azide, 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, 3,4,6-triacetate is a complex organic compound characterized by its azide functional group and a glucopyranosyl moiety. This compound features a sugar backbone, specifically derived from glucose, which is modified with acetyl groups at the 3, 4, and 6 positions, enhancing its solubility and reactivity. The presence of the azide group suggests potential applications in click chemistry, allowing for further functionalization and conjugation with other molecules. The isoindole derivative contributes to the compound's unique chemical properties, potentially influencing its reactivity and biological activity. This compound may be of interest in medicinal chemistry and bioconjugation studies due to its structural features, which can facilitate interactions with biological targets. Overall, its combination of carbohydrate and azide functionalities makes it a versatile candidate for various synthetic applications in organic and medicinal chemistry.

Formula: C₂₀H₂₀N₄O₉

InChI: InChI=1S/C20H20N4O9/c1-9(25)30-8-14-16(31-10(2)26)17(32-11(3)27)15(18(33-14)22-23-21)24-19(28)12-6-4-5-7-13(12)20(24)29/h4-7,14-18H,8H2,1-3H3/t14-,15-,16-,17-,18+/m1/s1

InChI key: InChIKey=UJSZDYIUFXNQKN-ZKXLYKBJSA-N

SMILES: O(C(C)=O)[C@@H]1[C@H]([C@@H](N=[N+]=[N-])O[C@H](COC(C)=O)[C@H]1OC(C)=O)N2C(=O)C=3C(C2=O)=CC=CC3

Synonyms:

• α-D-Glucopyranosyl azide, 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, 3,4,6-triacetate