CAS 102817-87-8

3-AMINO-N-(4-CHLOROPHENYL)-3-THIOXOPROPANAMIDE

Description:

3-Amino-N-(4-chlorophenyl)-3-thioxopropanamide, with the CAS number 102817-87-8, is a chemical compound characterized by its thioxoamide functional group, which features a sulfur atom double-bonded to a carbon atom within the amide structure. This compound typically exhibits properties associated with both amines and thioamides, including potential reactivity due to the presence of the amino group and the thioxo moiety. The 4-chlorophenyl substituent suggests that the compound may possess significant lipophilicity and could interact with biological systems, making it of interest in medicinal chemistry. Its structural features may confer specific biological activities, potentially influencing its solubility, stability, and reactivity. Additionally, the presence of the chlorine atom may enhance its pharmacological properties by modulating electronic characteristics. As with many thioamide derivatives, this compound may also exhibit tautomeric behavior, which can affect its reactivity and interaction with other molecules. Overall, the compound's unique structure positions it as a candidate for further investigation in various chemical and biological applications.

Formula: C₉H₉ClN₂OS

InChI: InChI=1/C9H9ClN2OS/c10-6-1-3-7(4-2-6)12-9(13)5-8(11)14/h1-4H,5H2,(H2,11,14)(H,12,13)

Synonyms:

• propanamide, 3-amino-N-(4-chlorophenyl)-3-thioxo-
• 3-Amino-N-(4-chlorophenyl)-3-thioxopropanamide