CAS 102818-95-1

2-(1,3-benzothiazol-2-yl)-L-homocysteine

Description:

2-(1,3-benzothiazol-2-yl)-L-homocysteine is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and an L-homocysteine backbone. This compound features a sulfur atom in its structure, which is typical of homocysteine derivatives, and it is known for its potential biological activity. The presence of the benzothiazole group may contribute to its pharmacological properties, as benzothiazoles are often associated with various biological activities, including antimicrobial and anticancer effects. The compound is likely to be soluble in polar solvents due to the presence of amino and thiol functional groups, which can participate in hydrogen bonding. Additionally, it may exhibit reactivity typical of thiols, such as forming disulfide bonds or participating in nucleophilic reactions. As with many sulfur-containing compounds, it may also play a role in redox chemistry. Overall, 2-(1,3-benzothiazol-2-yl)-L-homocysteine represents a class of compounds that could be of interest in medicinal chemistry and biochemistry.

Formula: C₁₁H₁₂N₂O₂S₂

InChI: InChI=1/C11H12N2O2S2/c12-11(5-6-16,10(14)15)9-13-7-3-1-2-4-8(7)17-9/h1-4,16H,5-6,12H2,(H,14,15)/t11-/m1/s1

SMILES: c1ccc2c(c1)nc([C@](CCS)(C(=O)O)N)s2