CymitQuimica logo

CAS 102822-05-9

:

1,2,3,4-tetrafluoro-5,8-dihydroxy-anthraquinone,

Description:
1,2,3,4-Tetrafluoro-5,8-dihydroxy-anthraquinone is a synthetic organic compound characterized by its anthraquinone structure, which consists of a three-ring system with two hydroxyl (-OH) groups and four fluorine atoms substituting hydrogen atoms. This compound exhibits notable chemical stability due to the robust carbon-carbon bonds in the anthraquinone framework. The presence of fluorine atoms enhances its lipophilicity and alters its electronic properties, potentially affecting its reactivity and interaction with biological systems. The hydroxyl groups contribute to its solubility in polar solvents and may facilitate hydrogen bonding, influencing its behavior in various chemical environments. This compound is of interest in fields such as dye chemistry, materials science, and potentially in medicinal chemistry due to its unique structural features. Its CAS number, 102822-05-9, allows for precise identification in chemical databases and literature. Overall, 1,2,3,4-tetrafluoro-5,8-dihydroxy-anthraquinone represents a versatile compound with applications that may leverage its distinctive chemical properties.
Formula:C14H4F4O4
InChI:InChI=1/C14H4F4O4/c15-9-7-8(10(16)12(18)11(9)17)14(22)6-4(20)2-1-3(19)5(6)13(7)21/h1-2,19-20H
SMILES:c1cc(c2c(c1O)C(=O)c1c(c(c(c(c1F)F)F)F)C2=O)O
Synonyms:
  • 1,2,3,4-Tetrafluoro-5,8-dihydroxyanthraquinone
  • 1,2,3,4-Tetrafluoro-5,8-Dihydroxyanthracene-9,10-Dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.