CAS 102822-66-2
:mannostatin B
Description:
Mannostatin B is a chemical compound classified as a glycopeptide, primarily known for its role as an inhibitor of glycosylation processes in biological systems. It is derived from certain microbial sources and exhibits a complex structure that includes amino acids and sugar moieties. Mannostatin B is particularly noted for its ability to interfere with the synthesis of glycoproteins, which are essential for various cellular functions, including cell signaling and immune responses. This compound has garnered interest in biochemical research and potential therapeutic applications, particularly in the context of cancer and other diseases where glycosylation plays a critical role. Its mechanism of action involves the inhibition of specific enzymes responsible for the addition of sugar residues to proteins, thereby affecting their stability and function. As with many bioactive compounds, the study of mannostatin B continues to evolve, with ongoing research aimed at elucidating its full range of biological effects and potential applications in medicine and biotechnology.
Formula:C6H13NO4S
InChI:InChI=1/C6H13NO4S/c1-12(11)6-2(7)3(8)4(9)5(6)10/h2-6,8-10H,7H2,1H3/t2-,3+,4+,5+,6+,12+/m0/s1
Synonyms:- 1,2,3-Cyclopentanetriol, 4-amino-5-(methylsulfinyl)-
- 1,2,3-Cyclopentanetriol, 4-amino-5-(methylsulfinyl)-, (1R-(1-alpha,2-alpha,3-alpha,4-alpha,5-beta(R*)))-
- (1R,2R,3R,4S,5R)-4-amino-5-[(R)-methylsulfinyl]cyclopentane-1,2,3-triol
- Mannostatin B
- (1R,2R,3R,4S,5R)-4-AMino-5-[(R)-Methylsulfinyl]-1,2,3-cyclopentanetriol
- (1R)-4α-Amino-5β-(methylsulfinyl)-1α,2α,3α-cyclopentanetriol
- 1,2,3-Cyclopentanetriol, 4-amino-5-[(R)-methylsulfinyl]-, (1R,2R,3R,4S,5R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
