CAS 1028252-14-3

1,7-Dichloro-4-isoquinolinol

Description:

1,7-Dichloro-4-isoquinolinol is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic aromatic system. The presence of two chlorine atoms at the 1 and 7 positions of the isoquinoline ring significantly influences its chemical properties, including its reactivity and solubility. This compound typically exhibits a pale to dark solid appearance, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The hydroxyl group at the 4-position contributes to its ability to participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the dichloro substitution pattern may impart unique electronic properties, making it a subject of interest in various chemical reactions and synthesis pathways. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 1,7-Dichloro-4-isoquinolinol is a compound of interest in both research and industrial applications.

Formula: C₉H₅Cl₂NO

InChI: InChI=1S/C9H5Cl2NO/c10-5-1-2-6-7(3-5)9(11)12-4-8(6)13/h1-4,13H

InChI key: InChIKey=QADGYVVEDMIFGA-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C(O)=CN1)C=CC(Cl)=C2

Synonyms:

• 1,7-Dichloro-4-isoquinolinol
• 4-Isoquinolinol, 1,7-dichloro-