CAS 10283-15-5
:2-chloro-3,4-dimethylphenol
Description:
2-Chloro-3,4-dimethylphenol is an organic compound characterized by the presence of a chlorinated phenolic structure. It features a chlorine atom and two methyl groups attached to a benzene ring, specifically at the 2, 3, and 4 positions. This compound typically appears as a solid or crystalline substance and is known for its antimicrobial properties, making it useful in various applications, including as a preservative and in antiseptic formulations. Its molecular structure contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The presence of the chlorine atom enhances its lipophilicity, which can influence its solubility in organic solvents. Additionally, 2-chloro-3,4-dimethylphenol may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its applications extend to the fields of pharmaceuticals, cosmetics, and industrial products, where it serves as an important intermediate or active ingredient.
Formula:C8H9ClO
InChI:InChI=1/C8H9ClO/c1-5-3-4-7(10)8(9)6(5)2/h3-4,10H,1-2H3
SMILES:Cc1ccc(c(c1C)Cl)O
Synonyms:- 3,4-Dimethyl-2-chlorophenol
- Phenol, 2-Chloro-3,4-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
