CAS 1028352-86-4
:4-(4-Hydroxyphenyl)-2-thiazoleacetonitrile
Description:
4-(4-Hydroxyphenyl)-2-thiazoleacetonitrile, identified by its CAS number 1028352-86-4, is an organic compound characterized by the presence of a thiazole ring and a hydroxyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic chemistry, which may contribute to its potential biological activity. The hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. The thiazole moiety is known for its role in various pharmacological applications, often exhibiting antimicrobial and anti-inflammatory properties. The presence of the acetonitrile functional group suggests potential applications in organic synthesis and as a building block in medicinal chemistry. Overall, this compound's unique structural features may make it of interest in research related to drug development and material science. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H8N2OS
InChI:InChI=1S/C11H8N2OS/c12-6-5-11-13-10(7-15-11)8-1-3-9(14)4-2-8/h1-4,7,14H,5H2
InChI key:InChIKey=CMIGLFUTBISGQV-UHFFFAOYSA-N
SMILES:C(C#N)C1=NC(=CS1)C2=CC=C(O)C=C2
Synonyms:- 2-Thiazoleacetonitrile, 4-(4-hydroxyphenyl)-
- 2-[4-(4-Hydroxyphenyl)-1,3-thiazol-2-yl]acetonitrile
- 4-(4-Hydroxyphenyl)-2-thiazoleacetonitrile
- 2-CyanoMethyl-4-(4-hydroxyphenyl)thiazole, 97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.