CAS 102841-42-9: mulberroside A
Description:Mulberroside A is a natural compound primarily derived from the Morus alba (white mulberry) plant, known for its potential health benefits. It belongs to the class of flavonoids and is characterized by its glycosylated structure, which contributes to its solubility and bioactivity. This compound exhibits various pharmacological properties, including antioxidant, anti-inflammatory, and antidiabetic effects, making it of interest in both traditional medicine and modern therapeutic applications. Mulberroside A has been studied for its ability to inhibit certain enzymes involved in carbohydrate metabolism, which may help in managing blood sugar levels. Additionally, it has shown potential in protecting against oxidative stress and promoting cardiovascular health. The compound is typically extracted from plant sources and may be utilized in dietary supplements and herbal formulations. Its safety profile and efficacy are subjects of ongoing research, highlighting the importance of understanding its mechanisms of action and potential interactions with other substances.
Formula:C26H32O14
InChI:InChI=1S/C26H32O14/c27-9-17-19(31)21(33)23(35)25(39-17)37-14-4-3-12(16(30)8-14)2-1-11-5-13(29)7-15(6-11)38-26-24(36)22(34)20(32)18(10-28)40-26/h1-8,17-36H,9-10H2/b2-1+/t17-,18-,19-,20-,21+,22+,23-,24-,25-,26-/m1/s1
InChI key:InChIKey=HPSWAEGGWLOOKT-VUNDNAJOSA-N
SMILES:OC=1C=C(OC2OC(CO)C(O)C(O)C2O)C=C(C=CC3=CC=C(OC4OC(CO)C(O)C(O)C4O)C=C3O)C1
- Synonyms:
- 2,5′-Dihydroxy-4,3′-bis(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-trans-stilbene
- 3-[(1E)-2-[4-(β-<span class="text-smallcaps">D</smallcap>-Glucopyranosyloxy)-2-hydroxyphenyl]ethenyl]-5-hydroxyphenyl β-<smallcap>D</span>-glucopyranoside
- 3-{(E)-2-[4-(beta-D-glucopyranosyloxy)-2-hydroxyphenyl]ethenyl}-5-hydroxyphenyl beta-D-glucopyranoside
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 3-[(1E)-2-[4-(β-<smallcap>D</span>-glucopyranosyloxy)-2-hydroxyphenyl]ethenyl]-5-hydroxyphenyl
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 3-[2-[4-(β-<smallcap>D</span>-glucopyranosyloxy)-2-hydroxyphenyl]ethenyl]-5-hydroxyphenyl, (E)-
