CAS 102841-46-3
:Moracin P
Description:
Moracin P, with the CAS number 102841-46-3, is a naturally occurring compound classified as a flavonoid. It is primarily derived from the Morus species, particularly mulberry trees. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Moracin P is characterized by its polyphenolic structure, which contributes to its ability to scavenge free radicals and modulate various biochemical pathways. Its solubility properties can vary, often being more soluble in organic solvents than in water, which influences its bioavailability and application in formulations. Additionally, Moracin P may interact with various cellular targets, leading to diverse effects on cell signaling and metabolism. Research continues to explore its potential therapeutic applications, particularly in the fields of cancer treatment and health promotion. As with many natural compounds, the efficacy and safety profiles of Moracin P require further investigation to fully understand its potential benefits and mechanisms of action.
Formula:C19H18O5
InChI:InChI=1S/C19H18O5/c1-19(2)18(22)7-11-3-10-6-15(23-16(10)9-17(11)24-19)12-4-13(20)8-14(21)5-12/h3-6,8-9,18,20-22H,7H2,1-2H3/t18-/m1/s1
InChI key:InChIKey=QFUCSEIKNTUPPA-GOSISDBHSA-N
SMILES:O[C@@H]1CC=2C=C3C(=CC2OC1(C)C)OC(=C3)C4=CC(O)=CC(O)=C4
Synonyms:- (-)-Moracin P
- (R)-(-)-Moracin P
- 1,3-Benzenediol, 5-[(6R)-6,7-dihydro-6-hydroxy-7,7-dimethyl-5H-furo[3,2-g][1]benzopyran-2-yl]-
- 5-(6-Hydroxy-7,7-dimethyl-3a,5,6,7-tetrahydro-4H-furo(3,2-g)(1)benzopyran-2-yl)-benzene-1,3-diol
- 5-[(6R)-6,7-Dihydro-6-hydroxy-7,7-dimethyl-5H-furo[3,2-g][1]benzopyran-2-yl]-1,3-benzenediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-[(6R)-6,7-Dihydro-6-hydroxy-7,7-dimethyl-5H-furo[3,2-g][1]benzopyran-2-yl]-1,3-benzenediol
CAS:Formula:C19H18O5Purity:98%Color and Shape:SolidMolecular weight:326.3432Moracin P
CAS:Moracin P,2-Arylbenzofuran derivative from Mori Cortex Radicis. Inhibits HIF-1. Reduces ROS generation. Neuroprotective and anti-inflammatory.Formula:C19H18O5Purity:98%Color and Shape:SolidMolecular weight:326.34Moracin P
CAS:Moracin P is a prenylated mulberrofuran that is an inhibitor of the enzyme hydroxylase. This leads to decreased production of prostaglandins, which are involved in inflammatory responses and pain. Moracin P has been shown to have anti-cancer properties and inhibitory effects on human immunodeficiency virus (HIV). Moracin P also inhibits oxidative stress and has been shown to be effective for treating diabetic neuropathy. Moracenin, a compound found in Moracin P, has been shown to have significant inhibitory activities against various enzymes such as cyclooxygenase-2, lipoxygenase, nitric oxide synthase, and phospholipase A2.Formula:C19H18O5Purity:Min. 95%Molecular weight:326.34 g/mol




