CAS 102850-29-3
:Inositol 1,3,4,5-tetraphosphate
Description:
Inositol 1,3,4,5-tetraphosphate (IP4) is a phosphorylated derivative of inositol, a six-carbon cyclic sugar alcohol that plays a crucial role in cellular signaling and metabolism. It is characterized by the presence of four phosphate groups attached to the inositol ring at the 1, 3, 4, and 5 positions. This compound is involved in various biological processes, including cell signaling pathways, particularly those related to calcium mobilization and the regulation of cellular functions. IP4 acts as a second messenger in signal transduction, influencing processes such as cell growth, differentiation, and apoptosis. It is soluble in water, which facilitates its role in cellular environments. The compound is also known to interact with various proteins and enzymes, contributing to its regulatory functions within the cell. Due to its significance in biological systems, inositol 1,3,4,5-tetraphosphate is of interest in research related to cell biology, neurobiology, and potential therapeutic applications.
Formula:C6H16O18P4
InChI:InChI=1/C6H16O18P4/c7-1-3(21-25(9,10)11)2(8)5(23-27(15,16)17)6(24-28(18,19)20)4(1)22-26(12,13)14/h1-8H,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/t1-,2-,3-,4+,5-,6-/s2
InChI key:InChIKey=CIPFCGZLFXVXBG-JEJWLACNNA-N
SMILES:O(P(=O)(O)O)[C@@H]1[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](O)[C@H]1OP(=O)(O)O
Synonyms:- (1R,3S,4S,6S)-4,6-dihydroxycyclohexane-1,2,3,5-tetrayl tetrakis[dihydrogen (phosphate)]
- D-Myo-Inositol 1,3,4,5-Tetrakis-*Phospha Te Ammonium
- IP4
- IP<sub>4</sub>
- Inositol 1,3,4,5-tetrakis(phosphate)
- Inositol 1,3,4,5-tetraphosphate
- Inositol-1,3,4,5-Tetrakisphosphate
- Inositoltetraphosphate
- Ins(1,3,4,5)P4, Nh4+
- Myo-Inositol 1,3,4,6-Tetrakis-Phosphate Ammonium Salt
- myo-Inositol 1,3,4,5-tetrakis(phosphate)
- myo-Inositol 1,3,4,5-tetraphosphate
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
D-myo-Inositol 1,3,4,5-tetrakis(phosphate) ammonium salt
CAS:Formula:C6H16O18P4·8NH3Molecular weight:636.32
