
CAS 102851-07-0
:rel-(1R,3S,4S,5S)-3,4-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxycyclohexanecarboxylic acid
Description:
The chemical substance known as rel-(1R,3S,4S,5S)-3,4-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxycyclohexanecarboxylic acid, with the CAS number 102851-07-0, is a complex organic compound characterized by its multi-functional structure. It features a cyclohexane ring with multiple hydroxyl groups, which contribute to its potential solubility in polar solvents and its reactivity. The presence of the bis-phenolic moiety suggests that it may exhibit antioxidant properties, as phenolic compounds are known for their ability to scavenge free radicals. Additionally, the compound's structure indicates potential applications in pharmaceuticals or as a biochemical agent, particularly due to the presence of the carboxylic acid functional group, which can participate in various chemical reactions. Its stereochemistry, denoted by the specific R and S configurations, may influence its biological activity and interactions with other molecules. Overall, this compound's unique characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C25H24O12
InChI:InChI=1/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,35H,11-12H2,(H,33,34)/t19-,20-,23-,25+/s2
InChI key:InChIKey=UFCLZKMFXSILNL-GWELMYFGNA-N
SMILES:O(C(C=CC1=CC(O)=C(O)C=C1)=O)[C@H]2[C@H](OC(C=CC3=CC(O)=C(O)C=C3)=O)C[C@@](C(O)=O)(O)C[C@H]2O
Synonyms:- rel-(1R,3S,4S,5S)-3,4-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxycyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-, (1α,3β,4α,5α)-
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxy-, (1R,3S,4S,5S)-rel-
- Cyclohexanecarboxylic acid, 3,4-bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxy-, (1R,3S,4S,5S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rel-(1R,3S,4S,5S)-3,4-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,5-dihydroxycyclohexanecarboxylic acid
CAS:Formula:C25H24O12Molecular weight:516.4509
