CAS 10286-53-0

2-CYCLOHEXYLAMINO-BENZOIC ACID

Description:

2-Cyclohexylamino-benzoic acid, with the CAS number 10286-53-0, is an organic compound characterized by the presence of both a cyclohexylamino group and a carboxylic acid functional group attached to a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The cyclohexylamino moiety contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as moderate acidity, with the carboxylic acid group capable of donating protons in solution. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of the cyclohexyl group may influence its lipophilicity and overall pharmacokinetic profile. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1/C13H17NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h4-5,8-10,14H,1-3,6-7H2,(H,15,16)

Synonyms:

• benzoic acid, 2-(cyclohexylamino)-
• 2-Cyclohexylamino-benzoic acid
• 2-(Cyclohexylamino)benzoic acid

2-(Cyclohexylamino)benzoic acid

CAS: 10286-53-0

Formula: C₁₃H₁₇NO₂

Molecular weight: 219.2796

Ref: IN-DA009MU7

2-(Cyclohexylamino)benzoic acid

CAS: 10286-53-0

2-(Cyclohexylamino)benzoic acid

Purity: 90%

Molecular weight: 219.28g/mol

Ref: 54-OR1044011

2-(Cyclohexylamino)benzoic acid

CAS: 10286-53-0

2-(Cyclohexylamino)benzoic acid is a chemical compound that reacts with aryl halides to form cyclic amines. The reaction proceeds by the formation of an intermediate, which is then hydrolyzed and decarboxylated to form the product. This reaction can be used for the synthesis of amines from either aromatic or aliphatic aryl chlorides. This process is often used in screening experiments because it has been shown to be selective for aryl halides and yields high yields. The addition of cross-coupling reactions can also yield high yields and produce desired products with good chemo- and regioselectivity. 2-(Cyclohexylamino)benzoic acid is also useful for the synthesis of hyperpolarized molecules for imaging studies, as well as in ultrafast experiments where transfer rates are important.

Formula: C₁₃H₁₇NO₂

Purity: Min. 95%

Molecular weight: 219.28 g/mol

Ref: 3D-KAA28653