CAS 10286-87-0
:2'-chloro-5'-methylbenzanilide
Description:
2'-Chloro-5'-methylbenzanilide, with the CAS number 10286-87-0, is an organic compound characterized by its structural features, which include a benzene ring substituted with a chloro group at the 2' position and a methyl group at the 5' position, along with an anilide functional group. This compound typically exhibits a solid state at room temperature and is likely to be sparingly soluble in water, while being more soluble in organic solvents due to its hydrophobic aromatic structure. The presence of the chloro substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methyl group may affect the compound's steric properties and electronic characteristics, which can be relevant in applications such as pharmaceuticals or agrochemicals. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can exhibit varying degrees of biological activity. Overall, 2'-chloro-5'-methylbenzanilide is a compound of interest in organic synthesis and medicinal chemistry.
Formula:C14H12ClNO
InChI:InChI=1/C14H12ClNO/c1-10-7-8-12(15)13(9-10)16-14(17)11-5-3-2-4-6-11/h2-9H,1H3,(H,16,17)
SMILES:Cc1ccc(c(c1)N=C(c1ccccc1)O)Cl
Synonyms:- N-(2-chloro-5-methylphenyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Chloro-5-methyl-N-phenylbenzamide
CAS:Formula:C14H12ClNOColor and Shape:SolidMolecular weight:245.7042


