CymitQuimica logo

CAS 102871-68-1

:

2,7,8-Trimethylquinoline

Description:
2,7,8-Trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that consists of a benzene ring fused to a pyridine ring. This compound features three methyl groups attached to the quinoline structure, specifically at the 2, 7, and 8 positions, which influences its chemical properties and reactivity. It is typically a yellow to brown liquid or solid, depending on its purity and temperature. 2,7,8-Trimethylquinoline exhibits moderate solubility in organic solvents and is less soluble in water due to its hydrophobic nature. The presence of the methyl groups can enhance its stability and alter its electronic properties, making it of interest in various chemical applications, including as a potential antioxidant or in the synthesis of other organic compounds. Additionally, its unique structure may impart specific biological activities, warranting further investigation in medicinal chemistry. As with many quinoline derivatives, it is essential to handle this compound with care, considering potential toxicity and environmental impact.
Formula:C12H13N
InChI:InChI=1S/C12H13N/c1-8-4-6-11-7-5-9(2)13-12(11)10(8)3/h4-7H,1-3H3
InChI key:InChIKey=OQMCEPGEODDVJR-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=CC1C)C=CC(C)=N2
Synonyms:
  • Quinoline, 2,7,8-trimethyl-
  • 2,7,8-Trimethylquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.