CAS 102871-69-2
:2,5,8-Trimethylquinoline
Description:
2,5,8-Trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features three methyl groups located at the 2, 5, and 8 positions of the quinoline structure, which influences its chemical properties and reactivity. It is typically a yellowish liquid or solid, depending on the temperature and purity, and is known for its aromatic odor. 2,5,8-Trimethylquinoline is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of multiple methyl groups enhances its stability and can affect its boiling and melting points. This compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of dyes, pharmaceuticals, and agrochemicals. Additionally, it may exhibit biological activity, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C12H13N
InChI:InChI=1S/C12H13N/c1-8-4-5-9(2)12-11(8)7-6-10(3)13-12/h4-7H,1-3H3
InChI key:InChIKey=BAPDDVZQIJZBPQ-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(C)=CC1)C=CC(C)=N2
Synonyms:- Quinoline, 2,5,8-Trimethyl-
- 2,5,8-Trimethylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
