CymitQuimica logo

CAS 102872-15-1

:

2,4,7,8-Tetramethylquinoline

Description:
2,4,7,8-Tetramethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features four methyl groups attached to the quinoline structure at the 2, 4, 7, and 8 positions, which significantly influence its physical and chemical properties. It is typically a yellow to brown solid at room temperature and is known for its relatively low solubility in water, but it can dissolve in organic solvents. The presence of multiple methyl groups enhances its hydrophobicity and may affect its reactivity and stability. 2,4,7,8-Tetramethylquinoline is of interest in various fields, including materials science and organic synthesis, due to its potential applications as a fluorescent probe or in the development of advanced materials. Additionally, it may exhibit biological activity, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H15N
InChI:InChI=1/C13H15N/c1-8-5-6-12-9(2)7-10(3)14-13(12)11(8)4/h5-7H,1-4H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.