CAS 102877-83-8

1,7-Naphthalenedicarboxaldehyde

Description:

1,7-Naphthalenedicarboxaldehyde, with the CAS number 102877-83-8, is an organic compound characterized by the presence of two aldehyde functional groups attached to a naphthalene ring at the 1 and 7 positions. This compound appears as a pale yellow to white crystalline solid and is known for its aromatic properties due to the naphthalene structure. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. The compound is often utilized in organic synthesis, particularly in the preparation of various derivatives and as a building block in the development of fluorescent materials and dyes. Its reactivity is primarily attributed to the aldehyde groups, which can undergo typical reactions such as oxidation, reduction, and condensation. Additionally, 1,7-naphthalenedicarboxaldehyde can serve as a ligand in coordination chemistry, forming complexes with transition metals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₁₂H₈O₂

InChI: InChI=1S/C12H8O2/c13-7-9-4-5-10-2-1-3-11(8-14)12(10)6-9/h1-8H

InChI key: InChIKey=OLSDXRNBPWAEDJ-UHFFFAOYSA-N

SMILES: C(=O)C=1C2=C(C=CC(C=O)=C2)C=CC1

Synonyms:

• 1,7-Naphthalenedicarboxaldehyde
• Naphthalene-1,7-dialdehyde