CAS 102877-84-9

Ethyl 5-methyl-1-oxaspiro[2.5]octane-2-carboxylate

Description:

Ethyl 5-methyl-1-oxaspiro[2.5]octane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a combination of an ester functional group and a cyclic ether. The presence of the ethyl ester indicates that it has a carboxylic acid derivative, contributing to its reactivity and potential applications in organic synthesis. The spirocyclic framework provides rigidity and can influence the compound's physical properties, such as boiling and melting points, as well as its solubility in various solvents. The methyl group at the 5-position adds to the steric bulk, which can affect the compound's interactions with other molecules. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which can be leveraged for the development of novel pharmaceuticals or polymers. As with many organic compounds, its behavior in chemical reactions, stability, and potential toxicity would need to be evaluated in specific contexts.

Formula: C₁₁H₁₈O₃

InChI: InChI=1S/C11H18O3/c1-3-13-10(12)9-11(14-9)6-4-5-8(2)7-11/h8-9H,3-7H2,1-2H3

InChI key: InChIKey=HSSYKKITNXXOMP-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1C2(O1)CC(C)CCC2

Synonyms:

• Ethyl 5-methyl-1-oxaspiro[2.5]octane-2-carboxylate
• 1-Oxaspiro[2.5]octane-2-carboxylic acid, 5-methyl-, ethyl ester