CAS 102878-15-9

7-Chloro-2-naphthalenesulfonic acid

Description:

7-Chloro-2-naphthalenesulfonic acid is an organic compound characterized by its naphthalene structure, which features a chlorine substituent at the 7-position and a sulfonic acid group at the 2-position. This compound is typically a white to light yellow solid and is soluble in water, reflecting the presence of the sulfonic acid group, which enhances its polarity. It is often used as a reagent in organic synthesis and as a dye intermediate due to its ability to form colored complexes. The sulfonic acid group imparts acidic properties, making it a weak acid, and it can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Additionally, 7-Chloro-2-naphthalenesulfonic acid can serve as a useful building block in the synthesis of more complex organic molecules. Safety data indicates that, like many sulfonic acids, it should be handled with care, as it may cause irritation to skin and eyes. Proper storage and handling procedures are essential to ensure safety in laboratory settings.

Formula: C₁₀H₇ClO₃S

InChI: InChI=1S/C10H7ClO3S/c11-9-3-1-7-2-4-10(15(12,13)14)6-8(7)5-9/h1-6H,(H,12,13,14)

InChI key: InChIKey=DLFQBQBIFQCKSO-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=CC2=C(C=C1)C=CC(Cl)=C2

Synonyms:

• 7-Chloro-2-naphthalenesulfonic acid
• 7-Chloronaphthalene-2-sulfonic acid
• 2-Naphthalenesulfonic acid, 7-chloro-