CymitQuimica logo

CAS 102878-92-2

:

3-Hydrazinyl-1-methylpiperidine

Description:
3-Hydrazinyl-1-methylpiperidine is an organic compound characterized by the presence of a hydrazine functional group attached to a piperidine ring. The piperidine structure consists of a six-membered ring containing one nitrogen atom, while the hydrazinyl group contributes to its reactivity and potential biological activity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and environmental conditions. It is soluble in polar solvents, which is common for compounds containing nitrogen functionalities. The presence of the hydrazinyl group suggests that it may participate in various chemical reactions, including those involving oxidation or coupling reactions, making it of interest in synthetic organic chemistry and potentially in medicinal chemistry. Additionally, due to its nitrogen-rich structure, it may exhibit properties relevant to pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as hydrazines are known to be toxic and potentially carcinogenic.
Formula:C6H15N3
InChI:InChI=1S/C6H15N3/c1-9-4-2-3-6(5-9)8-7/h6,8H,2-5,7H2,1H3
InChI key:InChIKey=GPEYBZCIGJTHSC-UHFFFAOYSA-N
SMILES:N(N)C1CN(C)CCC1
Synonyms:
  • Piperidine, 3-hydrazino-1-methyl-
  • 3-Hydrazinyl-1-methylpiperidine
  • Piperidine, 3-hydrazinyl-1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.