
CAS 102878-93-3
:3-(2-Bromo-4-methoxyphenyl)-2-propenoic acid
Description:
3-(2-Bromo-4-methoxyphenyl)-2-propenoic acid, with the CAS number 102878-93-3, is an organic compound characterized by its structure, which includes a propenoic acid moiety and a substituted phenyl group. The presence of a bromine atom and a methoxy group on the phenyl ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound typically exhibits moderate polarity due to the carboxylic acid functional group, which can participate in hydrogen bonding, influencing its solubility in polar solvents. The bromine substitution may enhance its electrophilic character, making it a candidate for various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the methoxy group can affect the electronic distribution within the molecule, potentially influencing its reactivity and interaction with biological systems. Overall, this compound may have applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules.
Formula:C10H9BrO3
InChI:InChI=1S/C10H9BrO3/c1-14-8-4-2-7(9(11)6-8)3-5-10(12)13/h2-6H,1H3,(H,12,13)
InChI key:InChIKey=SVYFKHQTEBUNEY-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(Br)C=C(OC)C=C1
Synonyms:- Cinnamic acid, 2-bromo-4-methoxy-
- 3-(2-Bromo-4-methoxyphenyl)-2-propenoic acid
- 2-Propenoic acid, 3-(2-bromo-4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.