
CAS 10288-13-8
:1,2-Dibromo-3-methylbutane
Description:
1,2-Dibromo-3-methylbutane is an organic compound characterized by its structure, which includes a butane backbone with two bromine atoms attached to the first and second carbon atoms, and a methyl group on the third carbon. This compound is a colorless to pale yellow liquid at room temperature and is known for its relatively high density compared to water. It is classified as a dibromoalkane and is primarily used in organic synthesis and as an intermediate in the production of other chemicals. The presence of bromine atoms contributes to its reactivity, making it a useful reagent in various chemical reactions, including nucleophilic substitutions. Additionally, 1,2-dibromo-3-methylbutane is considered to have moderate toxicity, and appropriate safety measures should be taken when handling it. Its molecular formula is C5H10Br2, and it exhibits characteristics typical of halogenated hydrocarbons, such as potential environmental persistence and bioaccumulation.
Formula:C5H10Br2
InChI:InChI=1S/C5H10Br2/c1-4(2)5(7)3-6/h4-5H,3H2,1-2H3
InChI key:InChIKey=XCVOFNNXLRFMGX-UHFFFAOYSA-N
SMILES:C(C(C)C)(CBr)Br
Synonyms:- 3,4-Dibromo-2-methylbutane
- Butane, 1,2-dibromo-3-methyl-
- 1,2-Dibromo-3-methylbutane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.