CAS 1028842-99-0
:5-(3-Fluorophenyl)-1H-pyrazol-3-amine
Description:
5-(3-Fluorophenyl)-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position relative to the amine group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group, which can participate in hydrogen bonding and nucleophilic reactions. The fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. The specific characteristics, including melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases.
Formula:C9H8FN3
InChI:InChI=1S/C9H8FN3/c10-7-3-1-2-6(4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13)
InChI key:InChIKey=JWISUMPCIIZLHQ-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C=2NN=C(N)C2
Synonyms:- 1H-Pyrazol-3-amine, 5-(3-fluorophenyl)-
- 3-Amino-5-(3-fluorophenyl)pyrazole
- 5-Amino-3-(3-fluorophenyl)-1H-pyrazole
- 5-(3-Fluorophenyl)-1H-pyrazol-3-amine
- [5-(3-Fluorophenyl)-1H-pyrazol-3-yl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
