CymitQuimica logo

CAS 1028843-03-9

:

5-(5-Bromo-2-furanyl)-1H-pyrazol-3-amine

Description:
5-(5-Bromo-2-furanyl)-1H-pyrazol-3-amine is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a brominated furan moiety. The presence of the bromine atom enhances its reactivity and may influence its biological activity. This compound typically exhibits properties associated with heterocyclic compounds, such as potential solubility in organic solvents and varying degrees of polarity depending on the substituents. The pyrazole ring contributes to its potential as a ligand in coordination chemistry or as a scaffold in medicinal chemistry, where it may exhibit pharmacological properties. Additionally, the furan ring can participate in various chemical reactions, including electrophilic substitutions. The compound's molecular structure suggests it may be of interest in research areas such as drug development or materials science. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with biological systems or other chemical entities.
Formula:C7H6BrN3O
InChI:InChI=1S/C7H6BrN3O/c8-6-2-1-5(12-6)4-3-7(9)11-10-4/h1-3H,(H3,9,10,11)
InChI key:InChIKey=JWLTUNHSNWSTDG-UHFFFAOYSA-N
SMILES:NC=1C=C(NN1)C=2OC(Br)=CC2
Synonyms:
  • 1H-Pyrazol-3-amine, 5-(5-bromo-2-furanyl)-
  • 5-(5-Bromo-2-furanyl)-1H-pyrazol-3-amine
  • 5-(5-Bromofuran-2-yl)-2H-pyrazol-3-ylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.