CAS 10289-94-8
:Octadecanoic acid, 41-hydroxy-3,6,9,12,15,18,21,24,27,30,33,36,39-tridecaoxahentetracont-1-yl ester
Description:
Octadecanoic acid, 41-hydroxy-3,6,9,12,15,18,21,24,27,30,33,36,39-tridecaoxahentetracont-1-yl ester, also known by its CAS number 10289-94-8, is a complex chemical compound characterized by its long-chain fatty acid structure combined with multiple ether linkages. This compound features a hydroxy group at the 41st position, which contributes to its potential reactivity and solubility properties. The presence of numerous ether groups indicates that it may exhibit unique physical properties, such as increased hydrophilicity compared to typical fatty acids. Its molecular structure suggests potential applications in various fields, including biochemistry and materials science, particularly in the development of surfactants, emulsifiers, or as a component in drug delivery systems. The compound's stability and behavior in different environments would depend on factors such as temperature, pH, and the presence of other chemical species. Overall, its intricate structure and functional groups make it a subject of interest for further research and application in specialized chemical processes.
Formula:C46H92O16
InChI:InChI=1S/C46H92O16/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-46(48)62-45-44-61-43-42-60-41-40-59-39-38-58-37-36-57-35-34-56-33-32-55-31-30-54-29-28-53-27-26-52-25-24-51-23-22-50-21-20-49-19-18-47/h47H,2-45H2,1H3
InChI key:InChIKey=PDASDZQPCWGLAC-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCCCCCCCCCCC)=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO
Synonyms:- 41-Hydroxy-3,6,9,12,15,18,21,24,27,30,33,36,39-tridecaoxahentetracontyl stearate
- Stearic acid, monoester with tetradecaethylene glycol
- Lipal 6S
- 41-hydroxy-3,6,9,12,15,18,21,24,27,30,33,36,39-tridecaoxahentetracont-1-yl octadecanoate
- Tetradecaethylene glycol, monostearate
- 41-Hydroxy-3,6,9,12,15,18,21,24,27,30,33,36,39-tridecaoxahentetracontyl stearate
- Octadecanoic acid, 41-hydroxy-3,6,9,12,15,18,21,24,27,30,33,36,39-tridecaoxahentetracont-1-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Octadecanoic acid,41-hydroxy-3,6,9,12,15,18,21,24,27,30,33,36,39-tridecaoxahentetracont-1-ylester
CAS:Formula:C46H92O16Molecular weight:901.2130800000015
