CymitQuimica logo

CAS 1029-96-5

:

2,6-diphenyl-4H-thiopyran-4-one

Description:
2,6-Diphenyl-4H-thiopyran-4-one, with the CAS number 1029-96-5, is an organic compound characterized by its unique thiopyran ring structure, which incorporates a sulfur atom within a six-membered ring. This compound features two phenyl groups attached to the 2 and 6 positions of the thiopyran ring, contributing to its aromatic properties and potential for various chemical interactions. It typically exhibits a yellow to orange coloration, indicative of its conjugated system, which can absorb light in the visible spectrum. The presence of the carbonyl group at the 4-position enhances its reactivity, making it a candidate for various chemical transformations. This compound is of interest in organic synthesis and materials science, particularly in the development of dyes and pigments due to its chromophoric properties. Additionally, its structural features may confer interesting biological activities, warranting further investigation in medicinal chemistry. Overall, 2,6-diphenyl-4H-thiopyran-4-one is a versatile compound with potential applications across multiple fields.
Formula:C17H12OS
InChI:InChI=1/C17H12OS/c18-15-11-16(13-7-3-1-4-8-13)19-17(12-15)14-9-5-2-6-10-14/h1-12H
SMILES:c1ccc(cc1)c1cc(=O)cc(c2ccccc2)s1
Synonyms:
  • 2,6-Diphenyl-4-thiopyrone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.