CAS 10291-39-1

2,2,2-trichloro-1-(2-chlorophenyl)ethanol

Description:

2,2,2-Trichloro-1-(2-chlorophenyl)ethanol, with the CAS number 10291-39-1, is an organic compound characterized by its chlorinated structure. It features a trichloroethyl group and a chlorophenyl moiety, which contribute to its chemical properties and reactivity. This compound is typically a colorless to pale yellow solid or liquid, depending on its specific formulation and purity. It is known for its use in various applications, including as an intermediate in organic synthesis and potentially in agrochemical formulations. The presence of multiple chlorine atoms enhances its lipophilicity, which can affect its bioavailability and environmental persistence. Additionally, the compound may exhibit antimicrobial properties, making it of interest in pharmaceutical and agricultural research. However, due to the presence of chlorine, it is essential to handle this substance with care, as chlorinated compounds can pose health and environmental risks. Proper safety measures should be taken when working with or disposing of this chemical.

Formula: C₈H₆Cl₄O

InChI: InChI=1/C8H6Cl4O/c9-6-4-2-1-3-5(6)7(13)8(10,11)12/h1-4,7,13H

SMILES: c1ccc(c(c1)C(C(Cl)(Cl)Cl)O)Cl

Synonyms:

• 1,1,1-Trichloro-2-(2-chlorophenyl)-2-hydroxyethane
• Benzenemethanol, 2-chloro-α-(trichloromethyl)-