CAS 1029104-54-8

Methyl 5-(1,3-benzodioxol-5-yl)-1H-pyrazole-3-carboxylate

Description:

Methyl 5-(1,3-benzodioxol-5-yl)-1H-pyrazole-3-carboxylate, with the CAS number 1029104-54-8, is a chemical compound characterized by its unique structural features, including a pyrazole ring and a benzodioxole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, which may influence its reactivity and interactions. It is often studied for its potential biological activities, including anti-inflammatory and analgesic effects, due to the presence of the pyrazole and benzodioxole groups, which are known to contribute to various pharmacological properties. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various synthetic applications. Additionally, the compound may undergo typical reactions associated with esters and heterocycles, such as hydrolysis and substitution reactions. Overall, Methyl 5-(1,3-benzodioxol-5-yl)-1H-pyrazole-3-carboxylate represents a compound of interest in medicinal chemistry and organic synthesis.

Formula: C₁₂H₁₀N₂O₄

InChI: InChI=1S/C12H10N2O4/c1-16-12(15)9-5-8(13-14-9)7-2-3-10-11(4-7)18-6-17-10/h2-5H,6H2,1H3,(H,13,14)

InChI key: InChIKey=TXRHHGNWAVUALM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=2C=C3C(=CC2)OCO3)NN1

Synonyms:

• Methyl 5-(1,3-benzodioxol-5-yl)-1H-pyrazole-3-carboxylate
• 1H-Pyrazole-3-carboxylic acid, 5-(1,3-benzodioxol-5-yl)-, methyl ester
• methyl 5-(2H-1,3-benzodioxol-5-yl)-1H-pyrazole-3-carboxylate

5-Benzo[1,3]dioxol-5-yl-1 H -pyrazole-3-carboxylic acid methyl ester

CAS: 1029104-54-8

Molecular weight: 246.2220001220703

Ref: 10-F027067

5-Benzo[1,3]dioxol-5-yl-2H-pyrazole-3-carboxylic acid methyl ester

CAS: 1029104-54-8

Versatile small molecule scaffold

Formula: C₁₂H₁₀N₂O₄

Purity: Min. 95%

Molecular weight: 246.22 g/mol

Ref: 3D-ERB10454