CAS 1029106-99-7

1-[[2-(2-Thienyl)imidazo[1,2-a]pyridin-3-yl]methyl]-2-piperidinecarboxylic acid

Description:

1-[[2-(2-Thienyl)imidazo[1,2-a]pyridin-3-yl]methyl]-2-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, an imidazo-pyridine moiety, and a thienyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the piperidine and imidazo-pyridine structures suggests that it may interact with biological targets, possibly influencing various signaling pathways. Its molecular framework allows for potential hydrogen bonding and π-π interactions, which can be crucial for its biological activity. Additionally, the thienyl group may contribute to the compound's electronic properties and stability. Overall, this compound's unique structural features position it as a candidate for further investigation in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₈H₁₉N₃O₂S

InChI: InChI=1S/C18H19N3O2S/c22-18(23)13-6-1-3-9-20(13)12-14-17(15-7-5-11-24-15)19-16-8-2-4-10-21(14)16/h2,4-5,7-8,10-11,13H,1,3,6,9,12H2,(H,22,23)

InChI key: InChIKey=LHKPCQSWYPIZBA-UHFFFAOYSA-N

SMILES: C(C1=C(N=C2N1C=CC=C2)C3=CC=CS3)N4C(C(O)=O)CCCC4

Synonyms:

• 2-Piperidinecarboxylic acid, 1-[[2-(2-thienyl)imidazo[1,2-a]pyridin-3-yl]methyl]-
• 1-[[2-(2-Thienyl)imidazo[1,2-a]pyridin-3-yl]methyl]-2-piperidinecarboxylic acid