CAS 1029107-56-9

3-Hydroxy-α-(phenylamino)benzeneacetic acid

Description:

3-Hydroxy-α-(phenylamino)benzeneacetic acid, also known by its CAS number 1029107-56-9, is an organic compound characterized by its aromatic structure and functional groups. It features a hydroxyl group (-OH) and an amino group (-NH2) attached to a benzene ring, contributing to its potential as a biologically active molecule. The presence of the phenylamino group suggests that it may exhibit properties related to amine chemistry, such as basicity and the ability to form hydrogen bonds. This compound may be of interest in pharmaceutical research due to its structural similarity to other biologically active compounds. Its solubility, stability, and reactivity can vary depending on the pH and the presence of other functional groups in a given environment. Additionally, the compound's potential applications could include roles in drug development, particularly in targeting specific biological pathways or as intermediates in synthetic chemistry. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c16-12-8-4-5-10(9-12)13(14(17)18)15-11-6-2-1-3-7-11/h1-9,13,15-16H,(H,17,18)

InChI key: InChIKey=WJHVYWXAJJKHRK-UHFFFAOYSA-N

SMILES: C(NC1=CC=CC=C1)(C(O)=O)C2=CC(O)=CC=C2

Synonyms:

• Benzeneacetic acid, 3-hydroxy-α-(phenylamino)-
• 3-Hydroxy-α-(phenylamino)benzeneacetic acid
• 2-(3-hydroxyphenyl)-2-(phenylamino)acetic acid

2-(3-hydroxyphenyl)-2-(phenylamino)acetic acid

CAS: 1029107-56-9

Formula: C₁₄H₁₃NO₃

Purity: 95.0%

Molecular weight: 243.262

Ref: 10-F526289