CymitQuimica logo

CAS 1029108-71-1

:

1-[[2-(1,3-Benzodioxol-5-yl)imidazo[1,2-a]pyrimidin-3-yl]methyl]-2-piperidinecarboxylic acid

Description:
1-[[2-(1,3-Benzodioxol-5-yl)imidazo[1,2-a]pyrimidin-3-yl]methyl]-2-piperidinecarboxylic acid is a complex organic compound characterized by its unique structural features, which include a piperidine ring and an imidazo-pyrimidine moiety. The presence of the benzodioxole group contributes to its potential biological activity, as this functional group is often associated with various pharmacological properties. The compound is likely to exhibit moderate to high solubility in organic solvents due to its diverse functional groups, while its carboxylic acid functionality may impart some degree of hydrophilicity. Additionally, the compound's molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its CAS number, 1029108-71-1, allows for precise identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, this compound represents a significant area of research, particularly in the context of developing new therapeutic agents.
Formula:C20H20N4O4
InChI:InChI=1S/C20H20N4O4/c25-19(26)14-4-1-2-8-23(14)11-15-18(22-20-21-7-3-9-24(15)20)13-5-6-16-17(10-13)28-12-27-16/h3,5-7,9-10,14H,1-2,4,8,11-12H2,(H,25,26)
InChI key:InChIKey=SFOSQZSNDIAKIK-UHFFFAOYSA-N
SMILES:C(C1=C(N=C2N1C=CC=N2)C=3C=C4C(=CC3)OCO4)N5C(C(O)=O)CCCC5
Synonyms:
  • 2-Piperidinecarboxylic acid, 1-[[2-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrimidin-3-yl]methyl]-
  • 1-[[2-(1,3-Benzodioxol-5-yl)imidazo[1,2-a]pyrimidin-3-yl]methyl]-2-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.