CymitQuimica logo

CAS 102916-95-0

:

(2R,4S)-6-fluoro-2-methyl-2,3-dihydro-2'H,5'H-spiro[chromene-4,4'-imidazolidine]-2',5'-dione

Description:
The chemical substance known as (2R,4S)-6-fluoro-2-methyl-2,3-dihydro-2'H,5'H-spiro[chromene-4,4'-imidazolidine]-2',5'-dione, with the CAS number 102916-95-0, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both chromene and imidazolidine moieties. This compound features a fluorine atom at the 6-position, contributing to its potential biological activity and reactivity. The presence of the methyl group at the 2-position and the specific stereochemistry (2R,4S) indicates that it has chiral centers, which may influence its pharmacological properties and interactions with biological targets. The dihydro and dione functionalities suggest that it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. Overall, this compound's structural characteristics may render it of interest in medicinal chemistry, particularly for the development of novel therapeutic agents. Further studies would be necessary to elucidate its specific properties, biological activities, and potential applications.
Formula:C12H11FN2O3
InChI:InChI=1/C12H11FN2O3/c1-6-5-12(10(16)14-11(17)15-12)8-4-7(13)2-3-9(8)18-6/h2-4,6H,5H2,1H3,(H2,14,15,16,17)/t6-,12+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.