CAS 102928-12-1

3,4-dimethylphenylmagnesium chloride

Description:

3,4-Dimethylphenylmagnesium chloride is an organomagnesium compound, specifically a Grignard reagent, characterized by its reactivity and utility in organic synthesis. It features a phenyl ring substituted with two methyl groups at the 3 and 4 positions, which influences its steric and electronic properties. As a Grignard reagent, it is highly reactive towards electrophiles, making it valuable for forming carbon-carbon bonds in various synthetic pathways. The presence of the magnesium atom allows it to act as a strong nucleophile, facilitating reactions with carbonyl compounds, alkyl halides, and other electrophilic species. Additionally, the chloride ion serves as a counterion, stabilizing the Grignard reagent in solution. Due to its reactivity, 3,4-dimethylphenylmagnesium chloride must be handled under anhydrous conditions to prevent hydrolysis by moisture, which can lead to the formation of unwanted byproducts. Overall, this compound is significant in the field of synthetic organic chemistry for its ability to generate complex molecules through various coupling reactions.

Formula: C₈H₉ClMg

InChI: InChI=1/C8H9.ClH.Mg/c1-7-5-3-4-6-8(7)2;;/h3,5-6H,1-2H3;1H;/q;;+1/p-1/rC8H9ClMg/c1-6-3-4-8(10-9)5-7(6)2/h3-5H,1-2H3

SMILES: CC1=CC=C=CC1C.Cl.[Mg]

Synonyms:

• Chloro-(3,4-Dimethylphenyl)Magnesium

3,4-Dimethylphenylmagnesium chloride 0.5 M in Tetrahydrofuran

CAS: 102928-12-1

Formula: C₈H₉ClMg

Molecular weight: 164.92

Ref: 10-F214146