CymitQuimica logo

CAS 102932-05-8

:

4-bromo-2-chlorophenyl acetate

Description:
4-Bromo-2-chlorophenyl acetate is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both bromine and chlorine atoms, as well as an acetate functional group. The presence of the bromine and chlorine substituents contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of more complex molecules. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care due to its potential toxicity and environmental impact. The compound may exhibit moderate solubility in organic solvents, while its solubility in water is generally low. Its chemical properties make it useful in fields such as pharmaceuticals, agrochemicals, and materials science, where it can serve as an intermediate in the synthesis of biologically active compounds. As with all chemical substances, proper safety protocols should be followed when handling 4-bromo-2-chlorophenyl acetate to mitigate any health risks.
Formula:C8H6BrClO2
InChI:InChI=1/C8H6BrClO2/c1-5(11)12-8-3-2-6(9)4-7(8)10/h2-4H,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.