CAS 1029413-48-6

1-[2-(1H-Imidazol-1-yl)ethyl]-1H-pyrazol-4-amine

Description:

1-[2-(1H-Imidazol-1-yl)ethyl]-1H-pyrazol-4-amine, with the CAS number 1029413-48-6, is a chemical compound characterized by its unique structural features, which include a pyrazole ring and an imidazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen-containing rings. It may display solubility in polar solvents, which is common for compounds with multiple nitrogen atoms. The presence of amine functional groups suggests that it could participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as many pyrazole and imidazole derivatives are known for their pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirming its structure. Overall, this compound represents a class of substances that could have significant implications in various fields, including pharmaceuticals and materials science.

Formula: C₈H₁₁N₅

InChI: InChI=1S/C8H11N5/c9-8-5-11-13(6-8)4-3-12-2-1-10-7-12/h1-2,5-7H,3-4,9H2

InChI key: InChIKey=UBUQQWXFFICLQF-UHFFFAOYSA-N

SMILES: C(CN1C=CN=C1)N2N=CC(N)=C2

Synonyms:

• 1H-Pyrazol-4-amine, 1-[2-(1H-imidazol-1-yl)ethyl]-
• 1-[2-(1H-Imidazol-1-yl)ethyl]-1H-pyrazol-4-amine