
CAS 1029419-85-9
:Ethyl 4-oxo-4H-pyrido[3,4-d][1,3]oxazine-2-carboxylate
Description:
Ethyl 4-oxo-4H-pyrido[3,4-d][1,3]oxazine-2-carboxylate is a heterocyclic compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine moiety. This compound typically exhibits a range of chemical properties, including the presence of a carbonyl group (indicated by "4-oxo") and an ester functional group (from the ethyl carboxylate). Its molecular structure suggests potential reactivity, particularly in nucleophilic substitution and condensation reactions. The compound may also display interesting biological activities, making it a candidate for pharmaceutical applications. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. The presence of multiple functional groups allows for diverse interactions, which can be explored in synthetic chemistry and material science. Overall, Ethyl 4-oxo-4H-pyrido[3,4-d][1,3]oxazine-2-carboxylate is a compound of interest in both academic research and industrial applications due to its unique structural features and potential utility.
Formula:C10H8N2O4
InChI:InChI=1S/C10H8N2O4/c1-2-15-10(14)8-12-7-5-11-4-3-6(7)9(13)16-8/h3-5H,2H2,1H3
InChI key:InChIKey=AKPLZDRUMYYGMH-UHFFFAOYSA-N
SMILES:O=C1C=2C(N=C(C(OCC)=O)O1)=CN=CC2
Synonyms:- Ethyl 4-oxo-4H-pyrido[3,4-d][1,3]oxazine-2-carboxylate
- 4H-Pyrido[3,4-d][1,3]oxazine-2-carboxylic acid, 4-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 4-oxo-4H-pyrido[3,4-d][1,3]oxazine-2-carboxylate
CAS:Formula:C10H8N2O4Molecular weight:220.1815
