CAS 10295-48-4
:2-CHLORO-N-(4-METHOXYPHENYL)-2-PHENYLACETAMIDE
Description:
2-Chloro-N-(4-methoxyphenyl)-2-phenylacetamide, with the CAS number 10295-48-4, is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent on the second carbon of the acetamide structure, along with a methoxy group attached to a phenyl ring, contributing to its overall aromatic character. The presence of multiple aromatic rings enhances its potential for various interactions, making it of interest in medicinal chemistry and pharmaceutical applications. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties, such as reactivity and stability, can be influenced by the electron-donating methoxy group and the electron-withdrawing chloro group. Additionally, the compound may possess biological activity, which warrants further investigation for potential therapeutic uses. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C15H14ClNO2
InChI:InChI=1/C15H14ClNO2/c1-19-13-9-7-12(8-10-13)17-15(18)14(16)11-5-3-2-4-6-11/h2-10,14H,1H3,(H,17,18)
SMILES:COc1ccc(cc1)NC(=O)C(c1ccccc1)Cl
Synonyms:- (2R)-2-chloro-N-(4-methoxyphenyl)-2-phenylethanamide
- (2S)-2-chloro-N-(4-methoxyphenyl)-2-phenylethanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
